C19H32FNO2SiSn — CID 59749488
tert-butyl-[[3-(3-fluoro-4-trimethylstannylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-dimethylsilane (PubChem CID 59749488) has the molecular formula C19H32FNO2SiSn and a molecular weight of 472.27 g/mol. Its IUPAC name is tert-butyl-[[3-(3-fluoro-4-trimethylstannylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-(3-fluoro-4-trimethylstannylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59749488 |
| Molecular Formula | C19H32FNO2SiSn |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | tert-butyl-[[3-(3-fluoro-4-trimethylstannylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC(c2ccc([Sn](C)(C)C)c(F)c2)=NO1 |
| InChI | InChI=1S/C16H23FNO2Si.3CH3.Sn/c1-16(2,3)21(4,5)19-11-14-10-15(18-20-14)12-7-6-8-13(17)9-12;;;;/h6-7,9,14H,10-11H2,1-5H3;3*1H3; |
| InChIKey | NKKYPXAAKOWVSE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|