About 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol
1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol (PubChem CID 59749562) has the molecular formula C30H24N4OS
and a molecular weight of 488.62 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol |
| PubChem CID | 59749562 |
| Molecular Formula | C30H24N4OS |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol |
| SMILES | CC(O)(c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)c1cccc2nsnc12 |
| InChI | InChI=1S/C30H24N4OS/c1-29(35,25-18-11-19-26-28(25)33-36-32-26)27-20-34(21-31-27)30(22-12-5-2-6-13-22,23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-21,35H,1H3 |
| InChIKey | IGLDIVWLJXUVBT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol?
The IUPAC name of 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol (CID 59749562) is 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol.
What is the SMILES notation for 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol?
The canonical SMILES for 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol is CC(O)(c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)c1cccc2nsnc12.
What is the InChIKey of 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol?
The InChIKey is IGLDIVWLJXUVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24N4OS/c1-29(35,25-18-11-19-26-28(25)33-36-32-26)27-20-34(21-31-27)30(22-12-5-2-6-13-22,23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-21,35H,1H3.
What are the key properties of 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol?
1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol has a molecular weight of 488.62 g/mol, XLogP of 5.98, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,1,3-benzothiadiazol-4-yl)-1-(1-tritylimidazol-4-yl)ethanol is sourced from PubChem (CID 59749562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).