About 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene
8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene (PubChem CID 597496) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene.
Molecular Properties
| Compound Name | 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene |
| PubChem CID | 597496 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene |
| SMILES | COC1(OC)C=CC2(C=C1)OCCO2 |
| InChI | InChI=1S/C10H14O4/c1-11-9(12-2)3-5-10(6-4-9)13-7-8-14-10/h3-6H,7-8H2,1-2H3 |
| InChIKey | MTBFMHCHVSNUMJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene?
The IUPAC name of 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene (CID 597496) is 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene.
What is the SMILES notation for 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene?
The canonical SMILES for 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene is COC1(OC)C=CC2(C=C1)OCCO2.
What is the InChIKey of 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene?
The InChIKey is MTBFMHCHVSNUMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-11-9(12-2)3-5-10(6-4-9)13-7-8-14-10/h3-6H,7-8H2,1-2H3.
What are the key properties of 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene?
8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene has a molecular weight of 198.22 g/mol, XLogP of 0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethoxy-1,4-dioxaspiro[4.5]deca-6,9-diene is sourced from PubChem (CID 597496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).