C39H38N2O2S — CID 59749762
6-cyclopentyl-10,10,16,16-tetramethyl-5-phenanthro[9,10-d][1,3]thiazol-2-yl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 59749762) has the molecular formula C39H38N2O2S and a molecular weight of 598.81 g/mol. Its IUPAC name is 6-cyclopentyl-10,10,16,16-tetramethyl-5-phenanthro[9,10-d][1,3]thiazol-2-yl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 6-cyclopentyl-10,10,16,16-tetramethyl-5-phenanthro[9,10-d][1,3]thiazol-2-yl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 59749762 |
| Molecular Formula | C39H38N2O2S |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 6-cyclopentyl-10,10,16,16-tetramethyl-5-phenanthro[9,10-d][1,3]thiazol-2-yl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c2c1cc1c(C2CCCC2)c(-c2nc4c5ccccc5c5ccccc5c4s2)c(=O)oc31 |
| InChI | InChI=1S/C39H38N2O2S/c1-38(2)17-19-41-20-18-39(3,4)31-33(41)28(38)21-27-29(22-11-5-6-12-22)30(37(42)43-34(27)31)36-40-32-25-15-9-7-13-23(25)24-14-8-10-16-26(24)35(32)44-36/h7-10,13-16,21-22H,5-6,11-12,17-20H2,1-4H3 |
| InChIKey | SXNAWOZYFMAXLI-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|