C14H25NO2 — CID 59750006
2-[(1S,2R,6S,8S)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]ethanamine (PubChem CID 59750006) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-[(1S,2R,6S,8S)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]ethanamine.
| Compound Name | 2-[(1S,2R,6S,8S)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]ethanamine |
|---|---|
| PubChem CID | 59750006 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 2-[(1S,2R,6S,8S)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]ethanamine |
| SMILES | CC1(C)O[C@H]2C[C@@H]3C[C@@H](C3(C)C)[C@@]2(CCN)O1 |
| InChI | InChI=1S/C14H25NO2/c1-12(2)9-7-10(12)14(5-6-15)11(8-9)16-13(3,4)17-14/h9-11H,5-8,15H2,1-4H3/t9-,10-,11-,14+/m0/s1 |
| InChIKey | PJXJBINZNKUZPS-AYGWYOGXSA-N |
| XLogP | 2.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |