About [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate
[6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate (PubChem CID 59750375) has the molecular formula C15H12N2O4S2
and a molecular weight of 348.41 g/mol. Its IUPAC name is [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate |
| PubChem CID | 59750375 |
| Molecular Formula | C15H12N2O4S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cccc(-c2nc(=O)c3ccccc3s2)n1 |
| InChI | InChI=1S/C15H12N2O4S2/c1-23(19,20)21-9-10-5-4-7-12(16-10)15-17-14(18)11-6-2-3-8-13(11)22-15/h2-8H,9H2,1H3 |
| InChIKey | HEZRQJJSCQKNMC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate?
The IUPAC name of [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate (CID 59750375) is [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate.
What is the SMILES notation for [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate?
The canonical SMILES for [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate is CS(=O)(=O)OCc1cccc(-c2nc(=O)c3ccccc3s2)n1.
What is the InChIKey of [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate?
The InChIKey is HEZRQJJSCQKNMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O4S2/c1-23(19,20)21-9-10-5-4-7-12(16-10)15-17-14(18)11-6-2-3-8-13(11)22-15/h2-8H,9H2,1H3.
What are the key properties of [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate?
[6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate has a molecular weight of 348.41 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-oxo-1,3-benzothiazin-2-yl)-2-pyridinyl]methyl methanesulfonate is sourced from PubChem (CID 59750375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).