About 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide
6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide (PubChem CID 59750644) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide |
| PubChem CID | 59750644 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc3c(c2)CC(=O)CC3)nc1 |
| InChI | InChI=1S/C16H14N2O3/c17-16(20)11-3-6-15(18-9-11)21-14-5-2-10-1-4-13(19)7-12(10)8-14/h2-3,5-6,8-9H,1,4,7H2,(H2,17,20) |
| InChIKey | VHNFYCCIDIOXIZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide?
The IUPAC name of 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide (CID 59750644) is 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide.
What is the SMILES notation for 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide?
The canonical SMILES for 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide is NC(=O)c1ccc(Oc2ccc3c(c2)CC(=O)CC3)nc1.
What is the InChIKey of 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide?
The InChIKey is VHNFYCCIDIOXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c17-16(20)11-3-6-15(18-9-11)21-14-5-2-10-1-4-13(19)7-12(10)8-14/h2-3,5-6,8-9H,1,4,7H2,(H2,17,20).
What are the key properties of 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide?
6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide has a molecular weight of 282.30 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(7-oxo-6,8-dihydro-5H-naphthalen-2-yl)oxy]pyridine-3-carboxamide is sourced from PubChem (CID 59750644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).