C22H19ClF2N2O3S — CID 59750830
N-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)butyl]pyridine-3-carboxamide (PubChem CID 59750830) has the molecular formula C22H19ClF2N2O3S and a molecular weight of 464.92 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)butyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59750830 |
| Molecular Formula | C22H19ClF2N2O3S |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)butyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1)c1cccnc1 |
| InChI | InChI=1S/C22H19ClF2N2O3S/c23-16-5-8-18(9-6-16)31(29,30)21(19-13-17(24)7-10-20(19)25)4-2-12-27-22(28)15-3-1-11-26-14-15/h1,3,5-11,13-14,21H,2,4,12H2,(H,27,28) |
| InChIKey | MTWGPCVCGQGFGE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|