About N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline
N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline (PubChem CID 59750860) has the molecular formula C25H27F2NO4S2
and a molecular weight of 507.62 g/mol. Its IUPAC name is N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline.
Molecular Properties
| Compound Name | N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline |
| PubChem CID | 59750860 |
| Molecular Formula | C25H27F2NO4S2 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline |
| SMILES | CS(=O)(=O)CCCCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H27F2NO4S2/c1-33(29,30)16-6-5-9-25(23-17-20(26)10-15-24(23)27)34(31,32)22-13-11-21(12-14-22)28-18-19-7-3-2-4-8-19/h2-4,7-8,10-15,17,25,28H,5-6,9,16,18H2,1H3 |
| InChIKey | PBTLPSPWFXRYMR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline?
The IUPAC name of N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline (CID 59750860) is N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline.
What is the SMILES notation for N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline?
The canonical SMILES for N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline is CS(=O)(=O)CCCCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(NCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline?
The InChIKey is PBTLPSPWFXRYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27F2NO4S2/c1-33(29,30)16-6-5-9-25(23-17-20(26)10-15-24(23)27)34(31,32)22-13-11-21(12-14-22)28-18-19-7-3-2-4-8-19/h2-4,7-8,10-15,17,25,28H,5-6,9,16,18H2,1H3.
What are the key properties of N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline?
N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline has a molecular weight of 507.62 g/mol, XLogP of 5.31, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[1-(2,5-difluorophenyl)-5-methylsulfonylpentyl]sulfonylaniline is sourced from PubChem (CID 59750860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).