C15H26O4 — CID 59751054
methyl 2-[[(2R,4S)-4-hydroxy-5,5,6-trimethyloxan-2-yl]methyl]-3-methylbut-2-enoate (PubChem CID 59751054) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl 2-[[(2R,4S)-4-hydroxy-5,5,6-trimethyloxan-2-yl]methyl]-3-methylbut-2-enoate.
| Compound Name | methyl 2-[[(2R,4S)-4-hydroxy-5,5,6-trimethyloxan-2-yl]methyl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 59751054 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | methyl 2-[[(2R,4S)-4-hydroxy-5,5,6-trimethyloxan-2-yl]methyl]-3-methylbut-2-enoate |
| SMILES | COC(=O)C(C[C@@H]1C[C@H](O)C(C)(C)C(C)O1)=C(C)C |
| InChI | InChI=1S/C15H26O4/c1-9(2)12(14(17)18-6)7-11-8-13(16)15(4,5)10(3)19-11/h10-11,13,16H,7-8H2,1-6H3/t10?,11-,13+/m1/s1 |
| InChIKey | CIHGFOWUFDNZJQ-ZNVNOEFISA-N |
| XLogP | 2.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|