C8H12O2 — CID 59751085
(2S,3S)-2,3,4-trimethyl-2,3-dihydropyran-6-one (PubChem CID 59751085) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (2S,3S)-2,3,4-trimethyl-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2,3,4-trimethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 59751085 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (2S,3S)-2,3,4-trimethyl-2,3-dihydropyran-6-one |
| SMILES | CC1=CC(=O)O[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C8H12O2/c1-5-4-8(9)10-7(3)6(5)2/h4,6-7H,1-3H3/t6-,7-/m0/s1 |
| InChIKey | ZGRTURSLMRZVDK-BQBZGAKWSA-N |
| XLogP | 1.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |