C29H40O10SSi — CID 59751249
[(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate (PubChem CID 59751249) has the molecular formula C29H40O10SSi and a molecular weight of 608.78 g/mol. Its IUPAC name is [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 59751249 |
| Molecular Formula | C29H40O10SSi |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate |
| SMILES | CO[C@H]1[C@@H](OC(C)=O)C(OC(C)=O)O[C@@]1(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)OS(C)(=O)=O |
| InChI | InChI=1S/C29H40O10SSi/c1-20(39-40(8,32)33)29(26(34-7)25(36-21(2)30)27(38-29)37-22(3)31)19-35-41(28(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,20,25-27H,19H2,1-8H3/t20-,25-,26+,27?,29+/m1/s1 |
| InChIKey | VPSPVXONHBIAAJ-VKTHAYCHSA-N |
| XLogP | 2.53 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|