C28H39O9SSiU- — CID 59751259
[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(2-methoxy-1-methylsulfonyloxyethyl)-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium (PubChem CID 59751259) has the molecular formula C28H39O9SSiU- and a molecular weight of 817.79 g/mol. Its IUPAC name is [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(2-methoxy-1-methylsulfonyloxyethyl)-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium.
| Compound Name | [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(2-methoxy-1-methylsulfonyloxyethyl)-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium |
|---|---|
| PubChem CID | 59751259 |
| Molecular Formula | C28H39O9SSiU- |
| Molecular Weight | 817.79 g/mol |
| Exact Mass | 817.26 |
| IUPAC Name | [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(2-methoxy-1-methylsulfonyloxyethyl)-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium |
| SMILES | COCC(OS(C)(=O)=O)[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[CH-][C@H](OC(C)=O)[C@@H]1OC.[U] |
| InChI | InChI=1S/C28H39O9SSi.U/c1-21(29)36-24-18-34-28(26(24)33-6,25(19-32-5)37-38(7,30)31)20-35-39(27(2,3)4,22-14-10-8-11-15-22)23-16-12-9-13-17-23;/h8-18,24-26H,19-20H2,1-7H3;/q-1;/t24-,25?,26-,28-;/m0./s1 |
| InChIKey | MWRUPMNHFFHCNB-GSDVQTDDSA-N |
| XLogP | 2.43 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|