C30H42O11SSi — CID 59751272
[(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-2-methoxy-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate (PubChem CID 59751272) has the molecular formula C30H42O11SSi and a molecular weight of 638.81 g/mol. Its IUPAC name is [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-2-methoxy-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-2-methoxy-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 59751272 |
| Molecular Formula | C30H42O11SSi |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-[(1R)-2-methoxy-1-methylsulfonyloxyethyl]oxolan-3-yl] acetate |
| SMILES | COC[C@@H](OS(C)(=O)=O)[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC |
| InChI | InChI=1S/C30H42O11SSi/c1-21(31)38-26-27(36-7)30(40-28(26)39-22(2)32,25(19-35-6)41-42(8,33)34)20-37-43(29(3,4)5,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,25-28H,19-20H2,1-8H3/t25-,26-,27+,28?,30+/m1/s1 |
| InChIKey | JILGDOSNWISIQY-JFWCWLIBSA-N |
| XLogP | 2.16 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|