About 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid
3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid (PubChem CID 59751678) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid |
| PubChem CID | 59751678 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid |
| SMILES | CNC1C=C(C(=O)O)NC1 |
| InChI | InChI=1S/C6H10N2O2/c1-7-4-2-5(6(9)10)8-3-4/h2,4,7-8H,3H2,1H3,(H,9,10) |
| InChIKey | AODXQOUVINANNK-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid?
The IUPAC name of 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid (CID 59751678) is 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid?
The canonical SMILES for 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid is CNC1C=C(C(=O)O)NC1.
What is the InChIKey of 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid?
The InChIKey is AODXQOUVINANNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-7-4-2-5(6(9)10)8-3-4/h2,4,7-8H,3H2,1H3,(H,9,10).
What are the key properties of 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid?
3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid has a molecular weight of 142.16 g/mol, XLogP of -0.85, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)-2,3-dihydro-1H-pyrrole-5-carboxylic acid is sourced from PubChem (CID 59751678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).