C11H18N4O — CID 59751875
8-[2-(ethylamino)ethyl]-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one (PubChem CID 59751875) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 8-[2-(ethylamino)ethyl]-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one.
| Compound Name | 8-[2-(ethylamino)ethyl]-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 59751875 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 8-[2-(ethylamino)ethyl]-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one |
| SMILES | CCNCCc1n[nH]c(=O)c2c1NCCC2 |
| InChI | InChI=1S/C11H18N4O/c1-2-12-7-5-9-10-8(4-3-6-13-10)11(16)15-14-9/h12-13H,2-7H2,1H3,(H,15,16) |
| InChIKey | IWBVYOWLBXCMCZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|