C13H20N2O — CID 59751878
4-pentyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one (PubChem CID 59751878) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-pentyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one.
| Compound Name | 4-pentyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 59751878 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-pentyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
| SMILES | CCCCCc1n[nH]c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C13H20N2O/c1-2-3-4-9-12-10-7-5-6-8-11(10)13(16)15-14-12/h2-9H2,1H3,(H,15,16) |
| InChIKey | QQPDCNRJGKMHTD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|