About 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide
4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 59751961) has the molecular formula C7H14N2O2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 59751961 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C7H14N2O2S/c10-12(11)3-1-9(2-4-12)7-5-8-6-7/h7-8H,1-6H2 |
| InChIKey | AIERFJIBCCZHKK-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide (CID 59751961) is 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide is O=S1(=O)CCN(C2CNC2)CC1.
What is the InChIKey of 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide?
The InChIKey is AIERFJIBCCZHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2S/c10-12(11)3-1-9(2-4-12)7-5-8-6-7/h7-8H,1-6H2.
What are the key properties of 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide?
4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide has a molecular weight of 190.27 g/mol, XLogP of -1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yl)-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 59751961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).