C21H25Cl2N3O3S2 — CID 59752137
butyl 2-[2-[(2R)-2-[(3,5-dichloroanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate (PubChem CID 59752137) has the molecular formula C21H25Cl2N3O3S2 and a molecular weight of 502.49 g/mol. Its IUPAC name is butyl 2-[2-[(2R)-2-[(3,5-dichloroanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate.
| Compound Name | butyl 2-[2-[(2R)-2-[(3,5-dichloroanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59752137 |
| Molecular Formula | C21H25Cl2N3O3S2 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | butyl 2-[2-[(2R)-2-[(3,5-dichloroanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCOC(=O)c1csc(SCCN2C(=O)CC[C@@H]2CNc2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C21H25Cl2N3O3S2/c1-2-3-7-29-20(28)18-13-31-21(25-18)30-8-6-26-17(4-5-19(26)27)12-24-16-10-14(22)9-15(23)11-16/h9-11,13,17,24H,2-8,12H2,1H3/t17-/m1/s1 |
| InChIKey | CXFBNXLBSFIJLF-QGZVFWFLSA-N |
| XLogP | 5.60 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|