About N-(2,4-difluorophenyl)-2,2-diphenylacetamide
N-(2,4-difluorophenyl)-2,2-diphenylacetamide (PubChem CID 597523) has the molecular formula C20H15F2NO
and a molecular weight of 323.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-2,2-diphenylacetamide |
| PubChem CID | 597523 |
| Molecular Formula | C20H15F2NO |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15F2NO/c21-16-11-12-18(17(22)13-16)23-20(24)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19H,(H,23,24) |
| InChIKey | UYXYIKVVSSOVQZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,4-difluorophenyl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-2,2-diphenylacetamide?
The IUPAC name of N-(2,4-difluorophenyl)-2,2-diphenylacetamide (CID 597523) is N-(2,4-difluorophenyl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(2,4-difluorophenyl)-2,2-diphenylacetamide?
The canonical SMILES for N-(2,4-difluorophenyl)-2,2-diphenylacetamide is O=C(Nc1ccc(F)cc1F)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(2,4-difluorophenyl)-2,2-diphenylacetamide?
The InChIKey is UYXYIKVVSSOVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2NO/c21-16-11-12-18(17(22)13-16)23-20(24)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19H,(H,23,24).
What are the key properties of N-(2,4-difluorophenyl)-2,2-diphenylacetamide?
N-(2,4-difluorophenyl)-2,2-diphenylacetamide has a molecular weight of 323.34 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-2,2-diphenylacetamide is sourced from PubChem (CID 597523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).