C16H20F12O3 — CID 59752408
2-[3-butan-2-yloxy-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 59752408) has the molecular formula C16H20F12O3 and a molecular weight of 488.31 g/mol. Its IUPAC name is 2-[3-butan-2-yloxy-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-butan-2-yloxy-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 59752408 |
| Molecular Formula | C16H20F12O3 |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-[3-butan-2-yloxy-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)OC1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20F12O3/c1-3-7(2)31-10-5-8(11(29,13(17,18)19)14(20,21)22)4-9(6-10)12(30,15(23,24)25)16(26,27)28/h7-10,29-30H,3-6H2,1-2H3 |
| InChIKey | QXKXAQSUESJECG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |