C16H23F3N2O5 — CID 59752847
tert-butyl N-[1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-4,4,4-trifluoro-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 59752847) has the molecular formula C16H23F3N2O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is tert-butyl N-[1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-4,4,4-trifluoro-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-4,4,4-trifluoro-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59752847 |
| Molecular Formula | C16H23F3N2O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | tert-butyl N-[1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-4,4,4-trifluoro-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C(NC(=O)OC(C)(C)C)C(=O)[C@@H]1C(=O)N(C)C(=O)[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C16H23F3N2O5/c1-7-9(13(24)21(6)12(7)23)11(22)10(8(2)16(17,18)19)20-14(25)26-15(3,4)5/h7-10H,1-6H3,(H,20,25)/t7-,8?,9+,10?/m0/s1 |
| InChIKey | UCWCRJKLHZLISE-QGVKSAJWSA-N |
| XLogP | 1.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|