C26H29NO3S — CID 59752876
4-[(2S)-2-[[4-(5-benzylthiophen-2-yl)phenoxy]methyl]pyrrolidin-1-yl]butanoic acid (PubChem CID 59752876) has the molecular formula C26H29NO3S and a molecular weight of 435.59 g/mol. Its IUPAC name is 4-[(2S)-2-[[4-(5-benzylthiophen-2-yl)phenoxy]methyl]pyrrolidin-1-yl]butanoic acid.
| Compound Name | 4-[(2S)-2-[[4-(5-benzylthiophen-2-yl)phenoxy]methyl]pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 59752876 |
| Molecular Formula | C26H29NO3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 4-[(2S)-2-[[4-(5-benzylthiophen-2-yl)phenoxy]methyl]pyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCC[C@H]1COc1ccc(-c2ccc(Cc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C26H29NO3S/c28-26(29)9-5-17-27-16-4-8-22(27)19-30-23-12-10-21(11-13-23)25-15-14-24(31-25)18-20-6-2-1-3-7-20/h1-3,6-7,10-15,22H,4-5,8-9,16-19H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | KIWOHIZJWUMILC-QFIPXVFZSA-N |
| XLogP | 5.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |