About [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium
[(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium (PubChem CID 59753083) has the molecular formula C17H23FNO3Y-
and a molecular weight of 397.28 g/mol. Its IUPAC name is [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium.
Molecular Properties
| Compound Name | [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium |
| PubChem CID | 59753083 |
| Molecular Formula | C17H23FNO3Y- |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium |
| SMILES | CCCC(=O)O[C@H](c1cc[c-]cc1)[C@@H](CF)NC(=O)C(C)C.[Y] |
| InChI | InChI=1S/C17H23FNO3.Y/c1-4-8-15(20)22-16(13-9-6-5-7-10-13)14(11-18)19-17(21)12(2)3;/h6-7,9-10,12,14,16H,4,8,11H2,1-3H3,(H,19,21);/q-1;/t14-,16-;/m1./s1 |
| InChIKey | GVFOQFCKEAYFIA-VNYZMKMESA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium?
The IUPAC name of [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium (CID 59753083) is [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium.
What is the SMILES notation for [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium?
The canonical SMILES for [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium is CCCC(=O)O[C@H](c1cc[c-]cc1)[C@@H](CF)NC(=O)C(C)C.[Y].
What is the InChIKey of [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium?
The InChIKey is GVFOQFCKEAYFIA-VNYZMKMESA-N. The full InChI is InChI=1S/C17H23FNO3.Y/c1-4-8-15(20)22-16(13-9-6-5-7-10-13)14(11-18)19-17(21)12(2)3;/h6-7,9-10,12,14,16H,4,8,11H2,1-3H3,(H,19,21);/q-1;/t14-,16-;/m1./s1.
What are the key properties of [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium?
[(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium has a molecular weight of 397.28 g/mol, XLogP of 2.98, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] butanoate;yttrium is sourced from PubChem (CID 59753083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).