C10H16O3 — CID 59753780
1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one (PubChem CID 59753780) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one.
| Compound Name | 1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 59753780 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1C(=O)CC |
| InChI | InChI=1S/C10H16O3/c1-5-7(11)9-8(6-2)12-10(3,4)13-9/h6,8-9H,2,5H2,1,3-4H3/t8-,9+/m0/s1 |
| InChIKey | GIVOTDXJTVHERI-DTWKUNHWSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|