C25H20F2N2O4S — CID 59753830
2-[3-[6-fluoro-2-[(3-fluorophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid (PubChem CID 59753830) has the molecular formula C25H20F2N2O4S and a molecular weight of 482.51 g/mol. Its IUPAC name is 2-[3-[6-fluoro-2-[(3-fluorophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[6-fluoro-2-[(3-fluorophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 59753830 |
| Molecular Formula | C25H20F2N2O4S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2-[3-[6-fluoro-2-[(3-fluorophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2c3ccc(F)cc3S(=O)(=O)N2Cc2cccc(F)c2)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C25H20F2N2O4S/c1-15-24(19-7-2-3-8-21(19)28(15)14-23(30)31)25-20-10-9-18(27)12-22(20)34(32,33)29(25)13-16-5-4-6-17(26)11-16/h2-12,25H,13-14H2,1H3,(H,30,31) |
| InChIKey | LTDKYGZNIVRRSM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|