C15H12ClF3N4O2 — CID 59754208
4-[(1S,7Z,7aR)-7-hydroxyimino-3-oxo-1-(trifluoromethyl)-1,5,6,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile (PubChem CID 59754208) has the molecular formula C15H12ClF3N4O2 and a molecular weight of 372.73 g/mol. Its IUPAC name is 4-[(1S,7Z,7aR)-7-hydroxyimino-3-oxo-1-(trifluoromethyl)-1,5,6,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile.
| Compound Name | 4-[(1S,7Z,7aR)-7-hydroxyimino-3-oxo-1-(trifluoromethyl)-1,5,6,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile |
|---|---|
| PubChem CID | 59754208 |
| Molecular Formula | C15H12ClF3N4O2 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-[(1S,7Z,7aR)-7-hydroxyimino-3-oxo-1-(trifluoromethyl)-1,5,6,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)N3CC/C(=N/O)[C@H]3[C@H]2C(F)(F)F)ccc(C#N)c1Cl |
| InChI | InChI=1S/C15H12ClF3N4O2/c1-7-10(3-2-8(6-20)11(7)16)23-13(15(17,18)19)12-9(21-25)4-5-22(12)14(23)24/h2-3,12-13,25H,4-5H2,1H3/b21-9-/t12-,13-/m0/s1 |
| InChIKey | ZVGBAHFJEGVFHS-YYZPVKLSSA-N |
| XLogP | 3.30 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|