C23H34ClN3O2Si — CID 59754270
4-[(1R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-propan-2-yl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile (PubChem CID 59754270) has the molecular formula C23H34ClN3O2Si and a molecular weight of 448.08 g/mol. Its IUPAC name is 4-[(1R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-propan-2-yl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile.
| Compound Name | 4-[(1R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-propan-2-yl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile |
|---|---|
| PubChem CID | 59754270 |
| Molecular Formula | C23H34ClN3O2Si |
| Molecular Weight | 448.08 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 4-[(1R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-propan-2-yl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)N3CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3[C@H]2C(C)C)ccc(C#N)c1Cl |
| InChI | InChI=1S/C23H34ClN3O2Si/c1-14(2)20-21-18(29-30(7,8)23(4,5)6)11-12-26(21)22(28)27(20)17-10-9-16(13-25)19(24)15(17)3/h9-10,14,18,20-21H,11-12H2,1-8H3/t18-,20-,21+/m1/s1 |
| InChIKey | RWBHOUFCEHCZKJ-NRSPTQNISA-N |
| XLogP | 5.95 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.08 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|