C21H27F4N3O2Si — CID 59754278
4-[(1S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-3-methylbenzonitrile (PubChem CID 59754278) has the molecular formula C21H27F4N3O2Si and a molecular weight of 457.54 g/mol. Its IUPAC name is 4-[(1S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-3-methylbenzonitrile.
| Compound Name | 4-[(1S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-3-methylbenzonitrile |
|---|---|
| PubChem CID | 59754278 |
| Molecular Formula | C21H27F4N3O2Si |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[(1S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)N3CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3[C@H]2C(F)(F)F)ccc(C#N)c1F |
| InChI | InChI=1S/C21H27F4N3O2Si/c1-12-14(8-7-13(11-26)16(12)22)28-18(21(23,24)25)17-15(9-10-27(17)19(28)29)30-31(5,6)20(2,3)4/h7-8,15,17-18H,9-10H2,1-6H3/t15-,17+,18+/m1/s1 |
| InChIKey | RQNJKSPIYQWAGG-NJAFHUGGSA-N |
| XLogP | 5.34 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|