About 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate
1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate (PubChem CID 59754332) has the molecular formula C18H35NO5Si
and a molecular weight of 373.57 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate |
| PubChem CID | 59754332 |
| Molecular Formula | C18H35NO5Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1C(O[Si](C)(C)C(C)(C)C)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO5Si/c1-17(2,3)23-16(21)19-12-10-11-13(14(19)15(20)22-7)24-25(8,9)18(4,5)6/h13-14H,10-12H2,1-9H3 |
| InChIKey | REVYZEAPEVXVFZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate (CID 59754332) is 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate is COC(=O)C1C(O[Si](C)(C)C(C)(C)C)CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate?
The InChIKey is REVYZEAPEVXVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO5Si/c1-17(2,3)23-16(21)19-12-10-11-13(14(19)15(20)22-7)24-25(8,9)18(4,5)6/h13-14H,10-12H2,1-9H3.
What are the key properties of 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate?
1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate has a molecular weight of 373.57 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate is sourced from PubChem (CID 59754332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).