C23H29N3OS — CID 59754471
3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-6,7-dihydropyrimido[4,5-d][3,1]benzoxazepine (PubChem CID 59754471) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-6,7-dihydropyrimido[4,5-d][3,1]benzoxazepine.
| Compound Name | 3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-6,7-dihydropyrimido[4,5-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 59754471 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-6,7-dihydropyrimido[4,5-d][3,1]benzoxazepine |
| SMILES | CCCCSc1ncc2c(n1)OC(C1CC=C(C)CC1C)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H29N3OS/c1-4-5-12-28-23-24-14-19-18-8-6-7-9-20(18)25-21(27-22(19)26-23)17-11-10-15(2)13-16(17)3/h6-10,14,16-17,21,25H,4-5,11-13H2,1-3H3 |
| InChIKey | BLSDQYCBOUSNRG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|