C21H19F3N6O2S — CID 59755088
6-ethoxy-11-(1-oxidopyridin-1-ium-4-yl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 59755088) has the molecular formula C21H19F3N6O2S and a molecular weight of 476.48 g/mol. Its IUPAC name is 6-ethoxy-11-(1-oxidopyridin-1-ium-4-yl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-ethoxy-11-(1-oxidopyridin-1-ium-4-yl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 59755088 |
| Molecular Formula | C21H19F3N6O2S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 6-ethoxy-11-(1-oxidopyridin-1-ium-4-yl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3cc[n+]([O-])cc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C21H19F3N6O2S/c1-2-32-18-17-16(27-20(28-18)29-9-5-25-6-10-29)15-13(21(22,23)24)11-14(26-19(15)33-17)12-3-7-30(31)8-4-12/h3-4,7-8,11,25H,2,5-6,9-10H2,1H3 |
| InChIKey | OUZQKDPOSCNYKY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|