C19H17Cl2N7S — CID 59755122
4,6-dichloro-13-ethyl-11-(4-pyrimidin-2-ylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 59755122) has the molecular formula C19H17Cl2N7S and a molecular weight of 446.37 g/mol. Its IUPAC name is 4,6-dichloro-13-ethyl-11-(4-pyrimidin-2-ylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4,6-dichloro-13-ethyl-11-(4-pyrimidin-2-ylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 59755122 |
| Molecular Formula | C19H17Cl2N7S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 4,6-dichloro-13-ethyl-11-(4-pyrimidin-2-ylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCc1cc(N2CCN(c3ncccn3)CC2)nc2sc3c(Cl)nc(Cl)nc3c12 |
| InChI | InChI=1S/C19H17Cl2N7S/c1-2-11-10-12(27-6-8-28(9-7-27)19-22-4-3-5-23-19)24-17-13(11)14-15(29-17)16(20)26-18(21)25-14/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | FCZJRFKJLCDQEY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |