C21H19F3N6OS — CID 59755130
6-ethoxy-4-piperazin-1-yl-11-pyridin-3-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 59755130) has the molecular formula C21H19F3N6OS and a molecular weight of 460.49 g/mol. Its IUPAC name is 6-ethoxy-4-piperazin-1-yl-11-pyridin-3-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-ethoxy-4-piperazin-1-yl-11-pyridin-3-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 59755130 |
| Molecular Formula | C21H19F3N6OS |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 6-ethoxy-4-piperazin-1-yl-11-pyridin-3-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3cccnc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C21H19F3N6OS/c1-2-31-18-17-16(28-20(29-18)30-8-6-25-7-9-30)15-13(21(22,23)24)10-14(27-19(15)32-17)12-4-3-5-26-11-12/h3-5,10-11,25H,2,6-9H2,1H3 |
| InChIKey | QLIIDOFGGBAUNH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |