About 1-hydroxy-3H-2,1-benzoxaborol-5-amine
1-hydroxy-3H-2,1-benzoxaborol-5-amine (PubChem CID 59755199) has the molecular formula C7H8BNO2
and a molecular weight of 148.96 g/mol. Its IUPAC name is 1-hydroxy-3H-2,1-benzoxaborol-5-amine.
Molecular Properties
| Compound Name | 1-hydroxy-3H-2,1-benzoxaborol-5-amine |
| PubChem CID | 59755199 |
| Molecular Formula | C7H8BNO2 |
| Molecular Weight | 148.96 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 1-hydroxy-3H-2,1-benzoxaborol-5-amine |
| SMILES | Nc1ccc2c(c1)COB2O |
| InChI | InChI=1S/C7H8BNO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10H,4,9H2 |
| InChIKey | SBHOFSMRVTYWOW-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.96 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3H-2,1-benzoxaborol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3H-2,1-benzoxaborol-5-amine?
The IUPAC name of 1-hydroxy-3H-2,1-benzoxaborol-5-amine (CID 59755199) is 1-hydroxy-3H-2,1-benzoxaborol-5-amine.
What is the SMILES notation for 1-hydroxy-3H-2,1-benzoxaborol-5-amine?
The canonical SMILES for 1-hydroxy-3H-2,1-benzoxaborol-5-amine is Nc1ccc2c(c1)COB2O.
What is the InChIKey of 1-hydroxy-3H-2,1-benzoxaborol-5-amine?
The InChIKey is SBHOFSMRVTYWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BNO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10H,4,9H2.
What are the key properties of 1-hydroxy-3H-2,1-benzoxaborol-5-amine?
1-hydroxy-3H-2,1-benzoxaborol-5-amine has a molecular weight of 148.96 g/mol, XLogP of -0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3H-2,1-benzoxaborol-5-amine is sourced from PubChem (CID 59755199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).