C43H30F6O7S — CID 59755403
3-[2-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]benzoyl]phenyl]-5-methylbenzoyl]benzenesulfonic acid (PubChem CID 59755403) has the molecular formula C43H30F6O7S and a molecular weight of 804.76 g/mol. Its IUPAC name is 3-[2-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]benzoyl]phenyl]-5-methylbenzoyl]benzenesulfonic acid.
| Compound Name | 3-[2-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]benzoyl]phenyl]-5-methylbenzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59755403 |
| Molecular Formula | C43H30F6O7S |
| Molecular Weight | 804.76 g/mol |
| Exact Mass | 804.16 |
| IUPAC Name | 3-[2-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]benzoyl]phenyl]-5-methylbenzoyl]benzenesulfonic acid |
| SMILES | COc1ccc(C(c2ccc(Oc3ccc(C(=O)c4ccc(-c5ccc(C)cc5C(=O)c5cccc(S(=O)(=O)O)c5)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C43H30F6O7S/c1-26-6-23-37(38(24-26)40(51)30-4-3-5-36(25-30)57(52,53)54)27-7-9-28(10-8-27)39(50)29-11-17-34(18-12-29)56-35-21-15-32(16-22-35)41(42(44,45)46,43(47,48)49)31-13-19-33(55-2)20-14-31/h3-25H,1-2H3,(H,52,53,54) |
| InChIKey | XBAVMCSTXMUPFA-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.76 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|