About 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione
4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione (PubChem CID 59755475) has the molecular formula C15H22S4
and a molecular weight of 330.61 g/mol. Its IUPAC name is 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione.
Molecular Properties
| Compound Name | 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione |
| PubChem CID | 59755475 |
| Molecular Formula | C15H22S4 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione |
| SMILES | CCCCCCCCCCc1c(S)c(=S)c(=S)c1=S |
| InChI | InChI=1S/C15H22S4/c1-2-3-4-5-6-7-8-9-10-11-12(16)14(18)15(19)13(11)17/h16H,2-10H2,1H3 |
| InChIKey | MOMXDAGAAFFXJK-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione?
The IUPAC name of 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione (CID 59755475) is 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione.
What is the SMILES notation for 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione?
The canonical SMILES for 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione is CCCCCCCCCCc1c(S)c(=S)c(=S)c1=S.
What is the InChIKey of 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione?
The InChIKey is MOMXDAGAAFFXJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22S4/c1-2-3-4-5-6-7-8-9-10-11-12(16)14(18)15(19)13(11)17/h16H,2-10H2,1H3.
What are the key properties of 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione?
4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione has a molecular weight of 330.61 g/mol, XLogP of 6.72, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione is sourced from PubChem (CID 59755475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).