About 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione
3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione (PubChem CID 59755480) has the molecular formula C7H8S3
and a molecular weight of 188.34 g/mol. Its IUPAC name is 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione.
Molecular Properties
| Compound Name | 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione |
| PubChem CID | 59755480 |
| Molecular Formula | C7H8S3 |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione |
| SMILES | CCCc1c(S)c(=S)c1=S |
| InChI | InChI=1S/C7H8S3/c1-2-3-4-5(8)7(10)6(4)9/h8H,2-3H2,1H3 |
| InChIKey | KGCWQGMVOLVLHR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione?
The IUPAC name of 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione (CID 59755480) is 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione.
What is the SMILES notation for 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione?
The canonical SMILES for 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione is CCCc1c(S)c(=S)c1=S.
What is the InChIKey of 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione?
The InChIKey is KGCWQGMVOLVLHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S3/c1-2-3-4-5(8)7(10)6(4)9/h8H,2-3H2,1H3.
What are the key properties of 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione?
3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione has a molecular weight of 188.34 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-4-sulfanylcyclobut-3-ene-1,2-dithione is sourced from PubChem (CID 59755480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).