About 2-butyl-3,4,5-triiminocyclopenten-1-amine
2-butyl-3,4,5-triiminocyclopenten-1-amine (PubChem CID 59755492) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-butyl-3,4,5-triiminocyclopenten-1-amine.
Molecular Properties
| Compound Name | 2-butyl-3,4,5-triiminocyclopenten-1-amine |
| PubChem CID | 59755492 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-butyl-3,4,5-triiminocyclopenten-1-amine |
| SMILES | [H]/N=c1/c(N)c(CCCC)c(=N/[H])/c1=N\[H] |
| InChI | InChI=1S/C9H14N4/c1-2-3-4-5-6(10)8(12)9(13)7(5)11/h10,12-13H,2-4,11H2,1H3/b10-6-,12-8+,13-9- |
| InChIKey | SVNAXKRFHVOHFW-IUGQJKNMSA-N |
| XLogP | -0.07 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-3,4,5-triiminocyclopenten-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3,4,5-triiminocyclopenten-1-amine?
The IUPAC name of 2-butyl-3,4,5-triiminocyclopenten-1-amine (CID 59755492) is 2-butyl-3,4,5-triiminocyclopenten-1-amine.
What is the SMILES notation for 2-butyl-3,4,5-triiminocyclopenten-1-amine?
The canonical SMILES for 2-butyl-3,4,5-triiminocyclopenten-1-amine is [H]/N=c1/c(N)c(CCCC)c(=N/[H])/c1=N\[H].
What is the InChIKey of 2-butyl-3,4,5-triiminocyclopenten-1-amine?
The InChIKey is SVNAXKRFHVOHFW-IUGQJKNMSA-N. The full InChI is InChI=1S/C9H14N4/c1-2-3-4-5-6(10)8(12)9(13)7(5)11/h10,12-13H,2-4,11H2,1H3/b10-6-,12-8+,13-9-.
What are the key properties of 2-butyl-3,4,5-triiminocyclopenten-1-amine?
2-butyl-3,4,5-triiminocyclopenten-1-amine has a molecular weight of 178.24 g/mol, XLogP of -0.07, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3,4,5-triiminocyclopenten-1-amine is sourced from PubChem (CID 59755492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).