About 2-butyl-3,4-diiminocyclobuten-1-amine
2-butyl-3,4-diiminocyclobuten-1-amine (PubChem CID 59755504) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-butyl-3,4-diiminocyclobuten-1-amine.
Molecular Properties
| Compound Name | 2-butyl-3,4-diiminocyclobuten-1-amine |
| PubChem CID | 59755504 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-butyl-3,4-diiminocyclobuten-1-amine |
| SMILES | [H]/N=c1/c(N)c(CCCC)/c1=N/[H] |
| InChI | InChI=1S/C8H13N3/c1-2-3-4-5-6(9)8(11)7(5)10/h9,11H,2-4,10H2,1H3/b9-6-,11-8+ |
| InChIKey | TZEHSLWRGJDQLT-DJAXYUIYSA-N |
| XLogP | 0.45 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-3,4-diiminocyclobuten-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3,4-diiminocyclobuten-1-amine?
The IUPAC name of 2-butyl-3,4-diiminocyclobuten-1-amine (CID 59755504) is 2-butyl-3,4-diiminocyclobuten-1-amine.
What is the SMILES notation for 2-butyl-3,4-diiminocyclobuten-1-amine?
The canonical SMILES for 2-butyl-3,4-diiminocyclobuten-1-amine is [H]/N=c1/c(N)c(CCCC)/c1=N/[H].
What is the InChIKey of 2-butyl-3,4-diiminocyclobuten-1-amine?
The InChIKey is TZEHSLWRGJDQLT-DJAXYUIYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-3-4-5-6(9)8(11)7(5)10/h9,11H,2-4,10H2,1H3/b9-6-,11-8+.
What are the key properties of 2-butyl-3,4-diiminocyclobuten-1-amine?
2-butyl-3,4-diiminocyclobuten-1-amine has a molecular weight of 151.21 g/mol, XLogP of 0.45, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3,4-diiminocyclobuten-1-amine is sourced from PubChem (CID 59755504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).