About 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid
3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 59755554) has the molecular formula C19H30O6
and a molecular weight of 354.44 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| PubChem CID | 59755554 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)OCCCOCOC1C2C=CC(CC2)C1C(=O)O |
| InChI | InChI=1S/C19H30O6/c1-4-19(2,3)18(22)24-11-5-10-23-12-25-16-14-8-6-13(7-9-14)15(16)17(20)21/h6,8,13-16H,4-5,7,9-12H2,1-3H3,(H,20,21) |
| InChIKey | ILBCLAVIXLKKOL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid?
The IUPAC name of 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (CID 59755554) is 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
What is the SMILES notation for 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid?
The canonical SMILES for 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid is CCC(C)(C)C(=O)OCCCOCOC1C2C=CC(CC2)C1C(=O)O.
What is the InChIKey of 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid?
The InChIKey is ILBCLAVIXLKKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O6/c1-4-19(2,3)18(22)24-11-5-10-23-12-25-16-14-8-6-13(7-9-14)15(16)17(20)21/h6,8,13-16H,4-5,7,9-12H2,1-3H3,(H,20,21).
What are the key properties of 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid?
3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid has a molecular weight of 354.44 g/mol, XLogP of 3.01, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,2-dimethylbutanoyloxy)propoxymethoxy]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid is sourced from PubChem (CID 59755554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).