C39H74O5Si3 — CID 59755730
methyl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,10,14,16-pentaenoate (PubChem CID 59755730) has the molecular formula C39H74O5Si3 and a molecular weight of 707.27 g/mol. Its IUPAC name is methyl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,10,14,16-pentaenoate.
| Compound Name | methyl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,10,14,16-pentaenoate |
|---|---|
| PubChem CID | 59755730 |
| Molecular Formula | C39H74O5Si3 |
| Molecular Weight | 707.27 g/mol |
| Exact Mass | 706.48 |
| IUPAC Name | methyl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,10,14,16-pentaenoate |
| SMILES | CC[C@H](/C=C/C=C\C[C@H](/C=C/C=C/C=C\[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H74O5Si3/c1-18-33(42-45(12,13)37(2,3)4)27-24-21-25-30-34(43-46(14,15)38(5,6)7)28-22-19-20-23-29-35(31-26-32-36(40)41-11)44-47(16,17)39(8,9)10/h19-25,27-29,33-35H,18,26,30-32H2,1-17H3/b20-19+,25-21-,27-24+,28-22+,29-23-/t33-,34+,35-/m1/s1 |
| InChIKey | NQYGCJOGVOGRHG-QLJAHRCUSA-N |
| XLogP | 12.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.27 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|