C15H15NO2 — CID 59755758
(3Z)-3-[(3-aminophenyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 59755758) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (3Z)-3-[(3-aminophenyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3Z)-3-[(3-aminophenyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 59755758 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (3Z)-3-[(3-aminophenyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | Nc1cccc(/C=C2\OC(=O)C3=C2CCCC3)c1 |
| InChI | InChI=1S/C15H15NO2/c16-11-5-3-4-10(8-11)9-14-12-6-1-2-7-13(12)15(17)18-14/h3-5,8-9H,1-2,6-7,16H2/b14-9- |
| InChIKey | UQEJHHJYHYHCBC-ZROIWOOFSA-N |
| XLogP | 3.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|