C21H26N4O2 — CID 59755820
(9R,10R)-10-[[(2R)-4-(4-aminophenyl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 59755820) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (9R,10R)-10-[[(2R)-4-(4-aminophenyl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-10-[[(2R)-4-(4-aminophenyl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 59755820 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (9R,10R)-10-[[(2R)-4-(4-aminophenyl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | C[C@H](CCc1ccc(N)cc1)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C21H26N4O2/c1-13(5-6-14-7-9-15(22)10-8-14)23-18-11-12-25-19-16(20(18)26)3-2-4-17(19)24-21(25)27/h2-4,7-10,13,18,20,23,26H,5-6,11-12,22H2,1H3,(H,24,27)/t13-,18-,20-/m1/s1 |
| InChIKey | TVCHIHZNYHSHJK-CFSSXQINSA-N |
| XLogP | 2.33 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|