C21H23F2N3O3 — CID 59755827
(9R,10R)-10-[4-(4,5-difluoro-2-hydroxyphenyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 59755827) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is (9R,10R)-10-[4-(4,5-difluoro-2-hydroxyphenyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-10-[4-(4,5-difluoro-2-hydroxyphenyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 59755827 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (9R,10R)-10-[4-(4,5-difluoro-2-hydroxyphenyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | CC(CCc1cc(F)c(F)cc1O)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C21H23F2N3O3/c1-11(5-6-12-9-14(22)15(23)10-18(12)27)24-17-7-8-26-19-13(20(17)28)3-2-4-16(19)25-21(26)29/h2-4,9-11,17,20,24,27-28H,5-8H2,1H3,(H,25,29)/t11?,17-,20-/m1/s1 |
| InChIKey | WPLCDLCCHMXPAP-GNPDSTMJSA-N |
| XLogP | 2.73 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |