C19H25N3S — CID 59755869
4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)-N,N-dimethylaniline (PubChem CID 59755869) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is 4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59755869 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3c(s2)CCN(C2CCC2)CC3)cc1 |
| InChI | InChI=1S/C19H25N3S/c1-21(2)15-8-6-14(7-9-15)19-20-17-10-12-22(16-4-3-5-16)13-11-18(17)23-19/h6-9,16H,3-5,10-13H2,1-2H3 |
| InChIKey | DPUPPXXFZIFIHK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|