C25H26ClF3N4O4 — CID 59756145
(2R)-1-[(3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 59756145) has the molecular formula C25H26ClF3N4O4 and a molecular weight of 538.95 g/mol. Its IUPAC name is (2R)-1-[(3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59756145 |
| Molecular Formula | C25H26ClF3N4O4 |
| Molecular Weight | 538.95 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (2R)-1-[(3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(OCC(F)(F)F)cc2Cl)c2ccccc2CN1C(=O)N1CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C25H26ClF3N4O4/c1-15-12-33(23(35)18-9-8-17(11-19(18)26)37-14-25(27,28)29)20-6-3-2-5-16(20)13-32(15)24(36)31-10-4-7-21(31)22(30)34/h2-3,5-6,8-9,11,15,21H,4,7,10,12-14H2,1H3,(H2,30,34)/t15-,21-/m1/s1 |
| InChIKey | YODODAYRLQVSGK-QVKFZJNVSA-N |
| XLogP | 4.20 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.95 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |