C15H16ClN3O2 — CID 59756651
(3S)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)piperidine-3-carboxamide (PubChem CID 59756651) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is (3S)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 59756651 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (3S)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc2cc[nH]c(=O)c2cc1Cl)[C@H]1CCCNC1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-12-7-11-9(3-5-18-15(11)21)6-13(12)19-14(20)10-2-1-4-17-8-10/h3,5-7,10,17H,1-2,4,8H2,(H,18,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | SWYSWGCWSQBRGL-JTQLQIEISA-N |
| XLogP | 2.12 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |