About 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium
5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium (PubChem CID 59757343) has the molecular formula C34H36IrNO2-
and a molecular weight of 682.88 g/mol. Its IUPAC name is 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium.
Molecular Properties
| Compound Name | 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium |
| PubChem CID | 59757343 |
| Molecular Formula | C34H36IrNO2- |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 683.24 |
| IUPAC Name | 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium |
| SMILES | CCC(C)COc1ccc(C2(c3ccc(OCC(C)CC)cc3)c3ccc[c-]c3-c3ncccc32)cc1.[Ir] |
| InChI | InChI=1S/C34H36NO2.Ir/c1-5-24(3)22-36-28-17-13-26(14-18-28)34(27-15-19-29(20-16-27)37-23-25(4)6-2)31-11-8-7-10-30(31)33-32(34)12-9-21-35-33;/h7-9,11-21,24-25H,5-6,22-23H2,1-4H3;/q-1; |
| InChIKey | ISVFWIQEWQBMIZ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium?
The IUPAC name of 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium (CID 59757343) is 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium.
What is the SMILES notation for 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium?
The canonical SMILES for 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium is CCC(C)COc1ccc(C2(c3ccc(OCC(C)CC)cc3)c3ccc[c-]c3-c3ncccc32)cc1.[Ir].
What is the InChIKey of 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium?
The InChIKey is ISVFWIQEWQBMIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H36NO2.Ir/c1-5-24(3)22-36-28-17-13-26(14-18-28)34(27-15-19-29(20-16-27)37-23-25(4)6-2)31-11-8-7-10-30(31)33-32(34)12-9-21-35-33;/h7-9,11-21,24-25H,5-6,22-23H2,1-4H3;/q-1;.
What are the key properties of 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium?
5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium has a molecular weight of 682.88 g/mol, XLogP of 8.09, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis[4-(2-methylbutoxy)phenyl]-9H-indeno[1,2-b]pyridin-9-ide;iridium is sourced from PubChem (CID 59757343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).