C25H18I2N2O2 — CID 59757609
4,12-diiodo-8,8-bis(4-methoxyphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 59757609) has the molecular formula C25H18I2N2O2 and a molecular weight of 632.24 g/mol. Its IUPAC name is 4,12-diiodo-8,8-bis(4-methoxyphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4,12-diiodo-8,8-bis(4-methoxyphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 59757609 |
| Molecular Formula | C25H18I2N2O2 |
| Molecular Weight | 632.24 g/mol |
| Exact Mass | 631.95 |
| IUPAC Name | 4,12-diiodo-8,8-bis(4-methoxyphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)c3ccc(I)nc3-c3nc(I)ccc32)cc1 |
| InChI | InChI=1S/C25H18I2N2O2/c1-30-17-7-3-15(4-8-17)25(16-5-9-18(31-2)10-6-16)19-11-13-21(26)28-23(19)24-20(25)12-14-22(27)29-24/h3-14H,1-2H3 |
| InChIKey | IUIRHSLYZWZHNL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.24 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|